About (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid
(2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 699360) has the molecular formula C10H10N2O4S
and a molecular weight of 254.27 g/mol. Its IUPAC name is (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 699360 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@@H](c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C10H10N2O4S/c13-10(14)8-5-17-9(11-8)6-1-3-7(4-2-6)12(15)16/h1-4,8-9,11H,5H2,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | WHEHQPOUIXMETN-IUCAKERBSA-N |
| XLogP | 1.38 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid (CID 699360) is (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)[C@@H]1CS[C@@H](c2ccc([N+](=O)[O-])cc2)N1.
What is the InChIKey of (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is WHEHQPOUIXMETN-IUCAKERBSA-N. The full InChI is InChI=1S/C10H10N2O4S/c13-10(14)8-5-17-9(11-8)6-1-3-7(4-2-6)12(15)16/h1-4,8-9,11H,5H2,(H,13,14)/t8-,9-/m0/s1.
What are the key properties of (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid?
(2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 254.27 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-(4-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 699360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).