(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid

C9H9Cl2NO2 — CID 6993646

IUPAC(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid
SMILESN[C@H](Cc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C9H9Cl2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m1/s1
InChIKeyNRCSJHVDTAAISV-MRVPVSSYSA-N
MW234.08 g/mol
LogP1.95
Rot. Bonds3

About (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid

(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid (PubChem CID 6993646) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid
PubChem CID6993646
Molecular FormulaC9H9Cl2NO2
Molecular Weight234.08 g/mol
Exact Mass233.00
IUPAC Name(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid
SMILESN[C@H](Cc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C9H9Cl2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m1/s1
InChIKeyNRCSJHVDTAAISV-MRVPVSSYSA-N
XLogP1.95
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.08
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid (CID 6993646) is (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid is N[C@H](Cc1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid?
The InChIKey is NRCSJHVDTAAISV-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9Cl2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m1/s1.
What are the key properties of (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid?
(2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid has a molecular weight of 234.08 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(3,4-dichlorophenyl)propanoic acid is sourced from PubChem (CID 6993646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).