About 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate
5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 6993802) has the molecular formula C5H2BrN2O4-
and a molecular weight of 233.98 g/mol. Its IUPAC name is 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| PubChem CID | 6993802 |
| Molecular Formula | C5H2BrN2O4- |
| Molecular Weight | 233.98 g/mol |
| Exact Mass | 232.92 |
| IUPAC Name | 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | O=C([O-])c1[nH]c(=O)[nH]c(=O)c1Br |
| InChI | InChI=1S/C5H3BrN2O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h(H,10,11)(H2,7,8,9,12)/p-1 |
| InChIKey | YQYHIPBLZSIHDI-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.98 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 6993802) is 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate is O=C([O-])c1[nH]c(=O)[nH]c(=O)c1Br.
What is the InChIKey of 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is YQYHIPBLZSIHDI-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H3BrN2O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h(H,10,11)(H2,7,8,9,12)/p-1.
What are the key properties of 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate?
5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 233.98 g/mol, XLogP of -1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 6993802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).