About 8-azaniumyloctanoate
8-azaniumyloctanoate (PubChem CID 6994258) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 8-azaniumyloctanoate.
Molecular Properties
| Compound Name | 8-azaniumyloctanoate |
| PubChem CID | 6994258 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 8-azaniumyloctanoate |
| SMILES | [NH3+]CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C8H17NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7,9H2,(H,10,11) |
| InChIKey | UQXNEWQGGVUVQA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-azaniumyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azaniumyloctanoate?
The IUPAC name of 8-azaniumyloctanoate (CID 6994258) is 8-azaniumyloctanoate.
What is the SMILES notation for 8-azaniumyloctanoate?
The canonical SMILES for 8-azaniumyloctanoate is [NH3+]CCCCCCCC(=O)[O-].
What is the InChIKey of 8-azaniumyloctanoate?
The InChIKey is UQXNEWQGGVUVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7,9H2,(H,10,11).
What are the key properties of 8-azaniumyloctanoate?
8-azaniumyloctanoate has a molecular weight of 159.23 g/mol, XLogP of -0.68, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azaniumyloctanoate is sourced from PubChem (CID 6994258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).