C9H17N — CID 6994352
(4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 6994352) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | (4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 6994352 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | C1CC[C@H]2NCCC[C@@H]2C1 |
| InChI | InChI=1S/C9H17N/c1-2-6-9-8(4-1)5-3-7-10-9/h8-10H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | POTIYWUALSJREP-DTWKUNHWSA-N |
| XLogP | 1.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |