About 2,2-dimethoxyethylazanium
2,2-dimethoxyethylazanium (PubChem CID 6994454) has the molecular formula C4H12NO2+
and a molecular weight of 106.15 g/mol. Its IUPAC name is 2,2-dimethoxyethylazanium.
Molecular Properties
| Compound Name | 2,2-dimethoxyethylazanium |
| PubChem CID | 6994454 |
| Molecular Formula | C4H12NO2+ |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.09 |
| IUPAC Name | 2,2-dimethoxyethylazanium |
| SMILES | COC(C[NH3+])OC |
| InChI | InChI=1S/C4H11NO2/c1-6-4(3-5)7-2/h4H,3,5H2,1-2H3/p+1 |
| InChIKey | QKWWDTYDYOFRJL-UHFFFAOYSA-O |
| XLogP | -1.15 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethylazanium?
The IUPAC name of 2,2-dimethoxyethylazanium (CID 6994454) is 2,2-dimethoxyethylazanium.
What is the SMILES notation for 2,2-dimethoxyethylazanium?
The canonical SMILES for 2,2-dimethoxyethylazanium is COC(C[NH3+])OC.
What is the InChIKey of 2,2-dimethoxyethylazanium?
The InChIKey is QKWWDTYDYOFRJL-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H11NO2/c1-6-4(3-5)7-2/h4H,3,5H2,1-2H3/p+1.
What are the key properties of 2,2-dimethoxyethylazanium?
2,2-dimethoxyethylazanium has a molecular weight of 106.15 g/mol, XLogP of -1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethylazanium is sourced from PubChem (CID 6994454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).