About (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one
(1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one (PubChem CID 6994514) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one.
Molecular Properties
| Compound Name | (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one |
| PubChem CID | 6994514 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one |
| SMILES | O=C1C2C[C@@H]3C1[C@H]3C2 |
| InChI | InChI=1S/C7H8O/c8-7-3-1-4-5(2-3)6(4)7/h3-6H,1-2H2/t3?,4-,5-,6?/m0/s1 |
| InChIKey | ITDQUAQMICQLER-CHJPALPBSA-N |
| XLogP | 0.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one?
The IUPAC name of (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one (CID 6994514) is (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one.
What is the SMILES notation for (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one?
The canonical SMILES for (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one is O=C1C2C[C@@H]3C1[C@H]3C2.
What is the InChIKey of (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one?
The InChIKey is ITDQUAQMICQLER-CHJPALPBSA-N. The full InChI is InChI=1S/C7H8O/c8-7-3-1-4-5(2-3)6(4)7/h3-6H,1-2H2/t3?,4-,5-,6?/m0/s1.
What are the key properties of (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one?
(1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one has a molecular weight of 108.14 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6S)-tricyclo[2.2.1.02,6]heptan-3-one is sourced from PubChem (CID 6994514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).