About 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole
6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 699474) has the molecular formula C9H7NO2S
and a molecular weight of 193.23 g/mol. Its IUPAC name is 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
Molecular Properties
| Compound Name | 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| PubChem CID | 699474 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | Cc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C9H7NO2S/c1-5-10-6-2-7-8(12-4-11-7)3-9(6)13-5/h2-3H,4H2,1H3 |
| InChIKey | DYHNUNYGLLPGKS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The IUPAC name of 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole (CID 699474) is 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
What is the SMILES notation for 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The canonical SMILES for 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole is Cc1nc2cc3c(cc2s1)OCO3.
What is the InChIKey of 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The InChIKey is DYHNUNYGLLPGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S/c1-5-10-6-2-7-8(12-4-11-7)3-9(6)13-5/h2-3H,4H2,1H3.
What are the key properties of 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole has a molecular weight of 193.23 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole is sourced from PubChem (CID 699474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).