About (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 699488) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 699488 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | O=C1C=C[C@@H]2CO[C@H]1O2 |
| InChI | InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m1/s1 |
| InChIKey | HITOXZPZGPXYHY-XINAWCOVSA-N |
| XLogP | -0.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 699488) is (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is O=C1C=C[C@@H]2CO[C@H]1O2.
What is the InChIKey of (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is HITOXZPZGPXYHY-XINAWCOVSA-N. The full InChI is InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m1/s1.
What are the key properties of (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 126.11 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 699488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).