C12H11NO2 — CID 699498
1-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 699498) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 699498 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C=CC2=O)c(C)c1 |
| InChI | InChI=1S/C12H11NO2/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-12(13)15/h3-7H,1-2H3 |
| InChIKey | LWFUFCYGHRBLDH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|