About 1-chloro-2-ethylbenzene
1-chloro-2-ethylbenzene (PubChem CID 6995) has the molecular formula C8H9Cl
and a molecular weight of 140.61 g/mol. Its IUPAC name is 1-chloro-2-ethylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-ethylbenzene |
| PubChem CID | 6995 |
| Molecular Formula | C8H9Cl |
| Molecular Weight | 140.61 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 1-chloro-2-ethylbenzene |
| SMILES | CCc1ccccc1Cl |
| InChI | InChI=1S/C8H9Cl/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| InChIKey | CVGAWKYSRYXQOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethylbenzene?
The IUPAC name of 1-chloro-2-ethylbenzene (CID 6995) is 1-chloro-2-ethylbenzene.
What is the SMILES notation for 1-chloro-2-ethylbenzene?
The canonical SMILES for 1-chloro-2-ethylbenzene is CCc1ccccc1Cl.
What is the InChIKey of 1-chloro-2-ethylbenzene?
The InChIKey is CVGAWKYSRYXQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3.
What are the key properties of 1-chloro-2-ethylbenzene?
1-chloro-2-ethylbenzene has a molecular weight of 140.61 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethylbenzene is sourced from PubChem (CID 6995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).