About (2S)-2-nitropropan-1-ol
(2S)-2-nitropropan-1-ol (PubChem CID 6995040) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is (2S)-2-nitropropan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-nitropropan-1-ol |
| PubChem CID | 6995040 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | (2S)-2-nitropropan-1-ol |
| SMILES | C[C@@H](CO)[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3/t3-/m0/s1 |
| InChIKey | PCNWBUOSTLGPMI-VKHMYHEASA-N |
| XLogP | -0.36 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-nitropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-nitropropan-1-ol?
The IUPAC name of (2S)-2-nitropropan-1-ol (CID 6995040) is (2S)-2-nitropropan-1-ol.
What is the SMILES notation for (2S)-2-nitropropan-1-ol?
The canonical SMILES for (2S)-2-nitropropan-1-ol is C[C@@H](CO)[N+](=O)[O-].
What is the InChIKey of (2S)-2-nitropropan-1-ol?
The InChIKey is PCNWBUOSTLGPMI-VKHMYHEASA-N. The full InChI is InChI=1S/C3H7NO3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3/t3-/m0/s1.
What are the key properties of (2S)-2-nitropropan-1-ol?
(2S)-2-nitropropan-1-ol has a molecular weight of 105.09 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-nitropropan-1-ol is sourced from PubChem (CID 6995040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).