C6H17N5O+2 — CID 6995104
[(4S)-5-amino-4-azaniumyl-5-oxopentyl]-(diaminomethylidene)azanium (PubChem CID 6995104) has the molecular formula C6H17N5O+2 and a molecular weight of 175.24 g/mol. Its IUPAC name is [(4S)-5-amino-4-azaniumyl-5-oxopentyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-5-amino-4-azaniumyl-5-oxopentyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 6995104 |
| Molecular Formula | C6H17N5O+2 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | [(4S)-5-amino-4-azaniumyl-5-oxopentyl]-(diaminomethylidene)azanium |
| SMILES | NC(=O)[C@@H]([NH3+])CCC[NH+]=C(N)N |
| InChI | InChI=1S/C6H15N5O/c7-4(5(8)12)2-1-3-11-6(9)10/h4H,1-3,7H2,(H2,8,12)(H4,9,10,11)/p+2/t4-/m0/s1 |
| InChIKey | ULEBESPCVWBNIF-BYPYZUCNSA-P |
| XLogP | -4.78 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | -4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|