C15H23N4O3+ — CID 6995333
(5R)-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 6995333) has the molecular formula C15H23N4O3+ and a molecular weight of 307.37 g/mol. Its IUPAC name is (5R)-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6995333 |
| Molecular Formula | C15H23N4O3+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (5R)-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)[C@@H](/C=N/CC[NH+]2CCCCC2)C1=O |
| InChI | InChI=1S/C15H22N4O3/c1-2-7-19-14(21)12(13(20)17-15(19)22)11-16-6-10-18-8-4-3-5-9-18/h2,11-12H,1,3-10H2,(H,17,20,22)/p+1/b16-11+/t12-/m1/s1 |
| InChIKey | TWQQHHAPPNLCCI-PILJQMSFSA-O |
| XLogP | -0.99 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|