About trans-(1S,2R)-2-tert-butylcyclohexan-1-ol
trans-(1S,2R)-2-tert-butylcyclohexan-1-ol (PubChem CID 6995535) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is trans-(1S,2R)-2-tert-butylcyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2R)-2-tert-butylcyclohexan-1-ol |
| PubChem CID | 6995535 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | trans-(1S,2R)-2-tert-butylcyclohexan-1-ol |
| SMILES | CC(C)(C)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H20O/c1-10(2,3)8-6-4-5-7-9(8)11/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | DLTWBMHADAJAAZ-IUCAKERBSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2R)-2-tert-butylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-tert-butylcyclohexan-1-ol?
The IUPAC name of trans-(1S,2R)-2-tert-butylcyclohexan-1-ol (CID 6995535) is trans-(1S,2R)-2-tert-butylcyclohexan-1-ol.
What is the SMILES notation for trans-(1S,2R)-2-tert-butylcyclohexan-1-ol?
The canonical SMILES for trans-(1S,2R)-2-tert-butylcyclohexan-1-ol is CC(C)(C)[C@H]1CCCC[C@@H]1O.
What is the InChIKey of trans-(1S,2R)-2-tert-butylcyclohexan-1-ol?
The InChIKey is DLTWBMHADAJAAZ-IUCAKERBSA-N. The full InChI is InChI=1S/C10H20O/c1-10(2,3)8-6-4-5-7-9(8)11/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of trans-(1S,2R)-2-tert-butylcyclohexan-1-ol?
trans-(1S,2R)-2-tert-butylcyclohexan-1-ol has a molecular weight of 156.27 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-tert-butylcyclohexan-1-ol is sourced from PubChem (CID 6995535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).