cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid

C5H8O2 — CID 6995703

IUPACcis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid
SMILESC[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C5H8O2/c1-3-2-4(3)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m0/s1
InChIKeyAYEGPMGNMOIHDL-IUYQGCFVSA-N
MW100.12 g/mol
LogP0.73
Rot. Bonds1

About cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid

cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid (PubChem CID 6995703) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid
PubChem CID6995703
Molecular FormulaC5H8O2
Molecular Weight100.12 g/mol
Exact Mass100.05
IUPAC Namecis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid
SMILESC[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C5H8O2/c1-3-2-4(3)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m0/s1
InChIKeyAYEGPMGNMOIHDL-IUYQGCFVSA-N
XLogP0.73
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500100.12
LogP ≤ 50.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid (CID 6995703) is cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid is C[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid?
The InChIKey is AYEGPMGNMOIHDL-IUYQGCFVSA-N. The full InChI is InChI=1S/C5H8O2/c1-3-2-4(3)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m0/s1.
What are the key properties of cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid has a molecular weight of 100.12 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 6995703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).