C20H17ClINO4 — CID 6996020
(5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 6996020) has the molecular formula C20H17ClINO4 and a molecular weight of 497.72 g/mol. Its IUPAC name is (5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6996020 |
| Molecular Formula | C20H17ClINO4 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | (5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C20H17ClINO4/c1-27-11-10-23-17(12-4-8-15(22)9-5-12)16(19(25)20(23)26)18(24)13-2-6-14(21)7-3-13/h2-9,17,24H,10-11H2,1H3/t17-/m0/s1 |
| InChIKey | DUZLDXPRUUOESQ-KRWDZBQOSA-N |
| XLogP | 4.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|