C14H9NO5S2-2 — CID 6996315
2-[[3-[(1R)-1-carboxylatoethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 6996315) has the molecular formula C14H9NO5S2-2 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[[3-[(1R)-1-carboxylatoethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | 2-[[3-[(1R)-1-carboxylatoethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6996315 |
| Molecular Formula | C14H9NO5S2-2 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-[[3-[(1R)-1-carboxylatoethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | C[C@H](C(=O)[O-])N1C(=O)C(=Cc2ccccc2C(=O)[O-])SC1=S |
| InChI | InChI=1S/C14H11NO5S2/c1-7(12(17)18)15-11(16)10(22-14(15)21)6-8-4-2-3-5-9(8)13(19)20/h2-7H,1H3,(H,17,18)(H,19,20)/p-2/t7-/m1/s1 |
| InChIKey | UMLMEGCPKUHICP-SSDOTTSWSA-L |
| XLogP | -0.61 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|