About 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline
1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 699634) has the molecular formula C16H10FN3
and a molecular weight of 263.28 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline |
| PubChem CID | 699634 |
| Molecular Formula | C16H10FN3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Fc1ccccc1-c1nnc2ccc3ccccc3n12 |
| InChI | InChI=1S/C16H10FN3/c17-13-7-3-2-6-12(13)16-19-18-15-10-9-11-5-1-4-8-14(11)20(15)16/h1-10H |
| InChIKey | PEEMALHNFXTACH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The IUPAC name of 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline (CID 699634) is 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline.
What is the SMILES notation for 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The canonical SMILES for 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline is Fc1ccccc1-c1nnc2ccc3ccccc3n12.
What is the InChIKey of 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The InChIKey is PEEMALHNFXTACH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN3/c17-13-7-3-2-6-12(13)16-19-18-15-10-9-11-5-1-4-8-14(11)20(15)16/h1-10H.
What are the key properties of 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline has a molecular weight of 263.28 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]quinoline is sourced from PubChem (CID 699634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).