About 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole
3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 699646) has the molecular formula C11H9FN2S
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 699646 |
| Molecular Formula | C11H9FN2S |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Fc1ccc(C2=CSC3=NCCN23)cc1 |
| InChI | InChI=1S/C11H9FN2S/c12-9-3-1-8(2-4-9)10-7-15-11-13-5-6-14(10)11/h1-4,7H,5-6H2 |
| InChIKey | HPOWALXKCNUALK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole (CID 699646) is 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole is Fc1ccc(C2=CSC3=NCCN23)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole?
The InChIKey is HPOWALXKCNUALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2S/c12-9-3-1-8(2-4-9)10-7-15-11-13-5-6-14(10)11/h1-4,7H,5-6H2.
What are the key properties of 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole?
3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole has a molecular weight of 220.27 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 699646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).