C17H20F3N4O3+ — CID 6996718
dimethyl-[3-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]propyl]azanium (PubChem CID 6996718) has the molecular formula C17H20F3N4O3+ and a molecular weight of 385.37 g/mol. Its IUPAC name is dimethyl-[3-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]propyl]azanium.
| Compound Name | dimethyl-[3-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 6996718 |
| Molecular Formula | C17H20F3N4O3+ |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | dimethyl-[3-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]propyl]azanium |
| SMILES | C[NH+](C)CCC/N=C/C1C(=O)NC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H19F3N4O3/c1-23(2)8-4-7-21-10-13-14(25)22-16(27)24(15(13)26)12-6-3-5-11(9-12)17(18,19)20/h3,5-6,9-10,13H,4,7-8H2,1-2H3,(H,22,25,27)/p+1/b21-10+ |
| InChIKey | AQPVKDPFMTXLPJ-UFFVCSGVSA-O |
| XLogP | 0.51 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|