C7H6N3O4S- — CID 6997145
2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]acetate (PubChem CID 6997145) has the molecular formula C7H6N3O4S- and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]acetate.
| Compound Name | 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]acetate |
|---|---|
| PubChem CID | 6997145 |
| Molecular Formula | C7H6N3O4S- |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]acetate |
| SMILES | O=C([O-])C/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C7H7N3O4S/c11-4(12)2-8-1-3-5(13)9-7(15)10-6(3)14/h1,3H,2H2,(H,11,12)(H2,9,10,13,14,15)/p-1/b8-1+ |
| InChIKey | FNYHNMINLKYYEL-UNXLUWIOSA-M |
| XLogP | -3.05 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|