About (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one
(4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 699724) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| PubChem CID | 699724 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | Cc1ccc(/C=C2/C(=O)ON=C2c2ccccc2)o1 |
| InChI | InChI=1S/C15H11NO3/c1-10-7-8-12(18-10)9-13-14(16-19-15(13)17)11-5-3-2-4-6-11/h2-9H,1H3/b13-9+ |
| InChIKey | VFAQKHZBOKAOSQ-UKTHLTGXSA-N |
| XLogP | 2.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The IUPAC name of (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one (CID 699724) is (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one.
What is the SMILES notation for (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The canonical SMILES for (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one is Cc1ccc(/C=C2/C(=O)ON=C2c2ccccc2)o1.
What is the InChIKey of (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The InChIKey is VFAQKHZBOKAOSQ-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H11NO3/c1-10-7-8-12(18-10)9-13-14(16-19-15(13)17)11-5-3-2-4-6-11/h2-9H,1H3/b13-9+.
What are the key properties of (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
(4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one has a molecular weight of 253.26 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(5-methylfuran-2-yl)methylidene]-3-phenyl-1,2-oxazol-5-one is sourced from PubChem (CID 699724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).