About 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole
6-(bromomethyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 699727) has the molecular formula C6H5BrN2S
and a molecular weight of 217.09 g/mol. Its IUPAC name is 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 699727 |
| Molecular Formula | C6H5BrN2S |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | BrCc1cn2ccsc2n1 |
| InChI | InChI=1S/C6H5BrN2S/c7-3-5-4-9-1-2-10-6(9)8-5/h1-2,4H,3H2 |
| InChIKey | VMKPKJCYGJDZBF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole (CID 699727) is 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole is BrCc1cn2ccsc2n1.
What is the InChIKey of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole?
The InChIKey is VMKPKJCYGJDZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN2S/c7-3-5-4-9-1-2-10-6(9)8-5/h1-2,4H,3H2.
What are the key properties of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole?
6-(bromomethyl)imidazo[2,1-b][1,3]thiazole has a molecular weight of 217.09 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 699727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).