C13H18N4O6 — CID 6997454
2-[[2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]acetyl]amino]acetate (PubChem CID 6997454) has the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[[2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]acetyl]amino]acetate.
| Compound Name | 2-[[2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 6997454 |
| Molecular Formula | C13H18N4O6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[[2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]acetyl]amino]acetate |
| SMILES | CCCCN1C(=O)NC(=O)[C@@H](/C=[NH+]/CC(=O)NCC(=O)[O-])C1=O |
| InChI | InChI=1S/C13H18N4O6/c1-2-3-4-17-12(22)8(11(21)16-13(17)23)5-14-6-9(18)15-7-10(19)20/h5,8H,2-4,6-7H2,1H3,(H,15,18)(H,19,20)(H,16,21,23)/b14-5+/t8-/m1/s1 |
| InChIKey | PYYDNJWMOOKBGX-VJYAUKRXSA-N |
| XLogP | -4.50 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|