C19H21NO3S2 — CID 6997594
6-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 6997594) has the molecular formula C19H21NO3S2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 6-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 6997594 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 6-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CC(=Cc1ccccc1)/C=C1\SC(=S)N(CCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C19H21NO3S2/c1-14(12-15-8-4-2-5-9-15)13-16-18(23)20(19(24)25-16)11-7-3-6-10-17(21)22/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,21,22)/b14-12?,16-13- |
| InChIKey | BUGHZIWCNKYWTD-QPDRTOICSA-N |
| XLogP | 4.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|