C24H23NO8 — CID 6997708
methyl 4-[(2S,3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 6997708) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is methyl 4-[(2S,3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6997708 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 4-[(2S,3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COCCN1C(=O)C(=O)/C(=C(\O)c2ccc3c(c2)OCCO3)[C@@H]1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H23NO8/c1-30-10-9-25-20(14-3-5-15(6-4-14)24(29)31-2)19(22(27)23(25)28)21(26)16-7-8-17-18(13-16)33-12-11-32-17/h3-8,13,20,26H,9-12H2,1-2H3/b21-19-/t20-/m0/s1 |
| InChIKey | PGCYODCIHLEOEM-LCPUNJGISA-N |
| XLogP | 2.31 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|