About 2,5-dipyridin-4-yl-1,3,4-oxadiazole
2,5-dipyridin-4-yl-1,3,4-oxadiazole (PubChem CID 699787) has the molecular formula C12H8N4O
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2,5-dipyridin-4-yl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-dipyridin-4-yl-1,3,4-oxadiazole |
| PubChem CID | 699787 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2,5-dipyridin-4-yl-1,3,4-oxadiazole |
| SMILES | c1cc(-c2nnc(-c3ccncc3)o2)ccn1 |
| InChI | InChI=1S/C12H8N4O/c1-5-13-6-2-9(1)11-15-16-12(17-11)10-3-7-14-8-4-10/h1-8H |
| InChIKey | FFGFSQOCKQVECP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dipyridin-4-yl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dipyridin-4-yl-1,3,4-oxadiazole?
The IUPAC name of 2,5-dipyridin-4-yl-1,3,4-oxadiazole (CID 699787) is 2,5-dipyridin-4-yl-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-dipyridin-4-yl-1,3,4-oxadiazole?
The canonical SMILES for 2,5-dipyridin-4-yl-1,3,4-oxadiazole is c1cc(-c2nnc(-c3ccncc3)o2)ccn1.
What is the InChIKey of 2,5-dipyridin-4-yl-1,3,4-oxadiazole?
The InChIKey is FFGFSQOCKQVECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O/c1-5-13-6-2-9(1)11-15-16-12(17-11)10-3-7-14-8-4-10/h1-8H.
What are the key properties of 2,5-dipyridin-4-yl-1,3,4-oxadiazole?
2,5-dipyridin-4-yl-1,3,4-oxadiazole has a molecular weight of 224.22 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipyridin-4-yl-1,3,4-oxadiazole is sourced from PubChem (CID 699787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).