C19H26N4O5 — CID 6997923
5-[2-(diethylamino)ethyliminomethyl]-1-(2,5-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6997923) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyliminomethyl]-1-(2,5-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-(diethylamino)ethyliminomethyl]-1-(2,5-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6997923 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 5-[2-(diethylamino)ethyliminomethyl]-1-(2,5-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)CC/N=C/C1C(=O)NC(=O)N(c2cc(OC)ccc2OC)C1=O |
| InChI | InChI=1S/C19H26N4O5/c1-5-22(6-2)10-9-20-12-14-17(24)21-19(26)23(18(14)25)15-11-13(27-3)7-8-16(15)28-4/h7-8,11-12,14H,5-6,9-10H2,1-4H3,(H,21,24,26)/b20-12+ |
| InChIKey | XSHXEHNEMZKSTF-UDWIEESQSA-N |
| XLogP | 1.32 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|