C23H17ClN3O5- — CID 6997994
2-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-ethoxy-4-nitrophenolate (PubChem CID 6997994) has the molecular formula C23H17ClN3O5- and a molecular weight of 450.86 g/mol. Its IUPAC name is 2-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-ethoxy-4-nitrophenolate.
| Compound Name | 2-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-ethoxy-4-nitrophenolate |
|---|---|
| PubChem CID | 6997994 |
| Molecular Formula | C23H17ClN3O5- |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-[[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-ethoxy-4-nitrophenolate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N/c2cc(-c3nc4cc(C)ccc4o3)ccc2Cl)c1[O-] |
| InChI | InChI=1S/C23H18ClN3O5/c1-3-31-21-11-16(27(29)30)9-15(22(21)28)12-25-18-10-14(5-6-17(18)24)23-26-19-8-13(2)4-7-20(19)32-23/h4-12,28H,3H2,1-2H3/p-1/b25-12+ |
| InChIKey | NALGWGWJWXRGIY-BRJLIKDPSA-M |
| XLogP | 5.59 |
| TPSA | 113.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|