About (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid
(E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 6998313) has the molecular formula C8H11NO5S
and a molecular weight of 233.24 g/mol. Its IUPAC name is (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid |
| PubChem CID | 6998313 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H11NO5S/c10-7(1-2-8(11)12)9-6-3-4-15(13,14)5-6/h1-2,6H,3-5H2,(H,9,10)(H,11,12)/b2-1+/t6-/m0/s1 |
| InChIKey | VOYVSADGIRQSIM-IPWVHJGXSA-N |
| XLogP | -1.07 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid (CID 6998313) is (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid is O=C(O)/C=C/C(=O)N[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid?
The InChIKey is VOYVSADGIRQSIM-IPWVHJGXSA-N. The full InChI is InChI=1S/C8H11NO5S/c10-7(1-2-8(11)12)9-6-3-4-15(13,14)5-6/h1-2,6H,3-5H2,(H,9,10)(H,11,12)/b2-1+/t6-/m0/s1.
What are the key properties of (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid?
(E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid has a molecular weight of 233.24 g/mol, XLogP of -1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 6998313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).