About 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate
4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate (PubChem CID 6998331) has the molecular formula C10H13N2O7-
and a molecular weight of 273.22 g/mol. Its IUPAC name is 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate |
| PubChem CID | 6998331 |
| Molecular Formula | C10H13N2O7- |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate |
| SMILES | COC(=O)CN(CC(=O)OC)NC(=O)C=CC(=O)[O-] |
| InChI | InChI=1S/C10H14N2O7/c1-18-9(16)5-12(6-10(17)19-2)11-7(13)3-4-8(14)15/h3-4H,5-6H2,1-2H3,(H,11,13)(H,14,15)/p-1 |
| InChIKey | NMVKLGPGOBNKFB-UHFFFAOYSA-M |
| XLogP | -3.03 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate?
The IUPAC name of 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate (CID 6998331) is 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate.
What is the SMILES notation for 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate?
The canonical SMILES for 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate is COC(=O)CN(CC(=O)OC)NC(=O)C=CC(=O)[O-].
What is the InChIKey of 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate?
The InChIKey is NMVKLGPGOBNKFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14N2O7/c1-18-9(16)5-12(6-10(17)19-2)11-7(13)3-4-8(14)15/h3-4H,5-6H2,1-2H3,(H,11,13)(H,14,15)/p-1.
What are the key properties of 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate?
4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate has a molecular weight of 273.22 g/mol, XLogP of -3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-bis(2-methoxy-2-oxoethyl)hydrazinyl]-4-oxobut-2-enoate is sourced from PubChem (CID 6998331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).