C19H20IN3O2 — CID 6998543
N-(4-iodophenyl)-4-[2-[1-(4-methylphenyl)ethenyl]hydrazinyl]-4-oxobutanamide (PubChem CID 6998543) has the molecular formula C19H20IN3O2 and a molecular weight of 449.29 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-[2-[1-(4-methylphenyl)ethenyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(4-iodophenyl)-4-[2-[1-(4-methylphenyl)ethenyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 6998543 |
| Molecular Formula | C19H20IN3O2 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-(4-iodophenyl)-4-[2-[1-(4-methylphenyl)ethenyl]hydrazinyl]-4-oxobutanamide |
| SMILES | C=C(NNC(=O)CCC(=O)Nc1ccc(I)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20IN3O2/c1-13-3-5-15(6-4-13)14(2)22-23-19(25)12-11-18(24)21-17-9-7-16(20)8-10-17/h3-10,22H,2,11-12H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | PKGVEXOLBORIJL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|