About (3S)-3-azaniumylpropane-1,1,3-tricarboxylate
(3S)-3-azaniumylpropane-1,1,3-tricarboxylate (PubChem CID 6998947) has the molecular formula C6H7NO6-2
and a molecular weight of 189.12 g/mol. Its IUPAC name is (3S)-3-azaniumylpropane-1,1,3-tricarboxylate.
Molecular Properties
| Compound Name | (3S)-3-azaniumylpropane-1,1,3-tricarboxylate |
| PubChem CID | 6998947 |
| Molecular Formula | C6H7NO6-2 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (3S)-3-azaniumylpropane-1,1,3-tricarboxylate |
| SMILES | [NH3+][C@@H](CC(C(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/p-2/t3-/m0/s1 |
| InChIKey | UHBYWPGGCSDKFX-VKHMYHEASA-L |
| XLogP | -6.15 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | -6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-azaniumylpropane-1,1,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-azaniumylpropane-1,1,3-tricarboxylate?
The IUPAC name of (3S)-3-azaniumylpropane-1,1,3-tricarboxylate (CID 6998947) is (3S)-3-azaniumylpropane-1,1,3-tricarboxylate.
What is the SMILES notation for (3S)-3-azaniumylpropane-1,1,3-tricarboxylate?
The canonical SMILES for (3S)-3-azaniumylpropane-1,1,3-tricarboxylate is [NH3+][C@@H](CC(C(=O)[O-])C(=O)[O-])C(=O)[O-].
What is the InChIKey of (3S)-3-azaniumylpropane-1,1,3-tricarboxylate?
The InChIKey is UHBYWPGGCSDKFX-VKHMYHEASA-L. The full InChI is InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/p-2/t3-/m0/s1.
What are the key properties of (3S)-3-azaniumylpropane-1,1,3-tricarboxylate?
(3S)-3-azaniumylpropane-1,1,3-tricarboxylate has a molecular weight of 189.12 g/mol, XLogP of -6.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-azaniumylpropane-1,1,3-tricarboxylate is sourced from PubChem (CID 6998947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).