About (3R)-3-aminopropane-1,1,3-tricarboxylic acid
(3R)-3-aminopropane-1,1,3-tricarboxylic acid (PubChem CID 6998949) has the molecular formula C6H9NO6
and a molecular weight of 191.14 g/mol. Its IUPAC name is (3R)-3-aminopropane-1,1,3-tricarboxylic acid.
Molecular Properties
| Compound Name | (3R)-3-aminopropane-1,1,3-tricarboxylic acid |
| PubChem CID | 6998949 |
| Molecular Formula | C6H9NO6 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (3R)-3-aminopropane-1,1,3-tricarboxylic acid |
| SMILES | N[C@H](CC(C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m1/s1 |
| InChIKey | UHBYWPGGCSDKFX-GSVOUGTGSA-N |
| XLogP | -1.43 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-aminopropane-1,1,3-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-aminopropane-1,1,3-tricarboxylic acid?
The IUPAC name of (3R)-3-aminopropane-1,1,3-tricarboxylic acid (CID 6998949) is (3R)-3-aminopropane-1,1,3-tricarboxylic acid.
What is the SMILES notation for (3R)-3-aminopropane-1,1,3-tricarboxylic acid?
The canonical SMILES for (3R)-3-aminopropane-1,1,3-tricarboxylic acid is N[C@H](CC(C(=O)O)C(=O)O)C(=O)O.
What is the InChIKey of (3R)-3-aminopropane-1,1,3-tricarboxylic acid?
The InChIKey is UHBYWPGGCSDKFX-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m1/s1.
What are the key properties of (3R)-3-aminopropane-1,1,3-tricarboxylic acid?
(3R)-3-aminopropane-1,1,3-tricarboxylic acid has a molecular weight of 191.14 g/mol, XLogP of -1.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-aminopropane-1,1,3-tricarboxylic acid is sourced from PubChem (CID 6998949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).