C6F5O3S- — CID 6999133
2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 6999133) has the molecular formula C6F5O3S- and a molecular weight of 247.12 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 6999133 |
| Molecular Formula | C6F5O3S- |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5O3S/c7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h(H,12,13,14)/p-1 |
| InChIKey | IKMBXKGUMLSBOT-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|