C8H16N2O4 — CID 6999256
(2R,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide (PubChem CID 6999256) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide.
| Compound Name | (2R,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide |
|---|---|
| PubChem CID | 6999256 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide |
| SMILES | CN(C)C(=O)[C@@H](O)[C@@H](O)C(=O)N(C)C |
| InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6+ |
| InChIKey | PCYDYHRBODKVEL-OLQVQODUSA-N |
| XLogP | -2.12 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |