C11H11NO2S — CID 699928
N-(4,5-dimethylthiophen-2-yl)furan-2-carboxamide (PubChem CID 699928) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is N-(4,5-dimethylthiophen-2-yl)furan-2-carboxamide.
| Compound Name | N-(4,5-dimethylthiophen-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 699928 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | N-(4,5-dimethylthiophen-2-yl)furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C |
| InChI | InChI=1S/C11H11NO2S/c1-7-6-10(15-8(7)2)12-11(13)9-4-3-5-14-9/h3-6H,1-2H3,(H,12,13) |
| InChIKey | JIWAQXSXXWIDMN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |