About 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one
2-(3-methoxyphenyl)-3,1-benzoxazin-4-one (PubChem CID 699931) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one |
| PubChem CID | 699931 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one |
| SMILES | COc1cccc(-c2nc3ccccc3c(=O)o2)c1 |
| InChI | InChI=1S/C15H11NO3/c1-18-11-6-4-5-10(9-11)14-16-13-8-3-2-7-12(13)15(17)19-14/h2-9H,1H3 |
| InChIKey | DVJLPHFMBUSVQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one?
The IUPAC name of 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one (CID 699931) is 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one?
The canonical SMILES for 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one is COc1cccc(-c2nc3ccccc3c(=O)o2)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one?
The InChIKey is DVJLPHFMBUSVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3/c1-18-11-6-4-5-10(9-11)14-16-13-8-3-2-7-12(13)15(17)19-14/h2-9H,1H3.
What are the key properties of 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one?
2-(3-methoxyphenyl)-3,1-benzoxazin-4-one has a molecular weight of 253.26 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-3,1-benzoxazin-4-one is sourced from PubChem (CID 699931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).