C12H18ClN3O3 — CID 6999512
5-(3-chloropropyliminomethyl)-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 6999512) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 5-(3-chloropropyliminomethyl)-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(3-chloropropyliminomethyl)-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6999512 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-(3-chloropropyliminomethyl)-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(/C=N/CCCCl)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C12H18ClN3O3/c1-3-15-10(17)9(8-14-7-5-6-13)11(18)16(4-2)12(15)19/h8-9H,3-7H2,1-2H3/b14-8+ |
| InChIKey | XBNREAWEAVLEJA-RIYZIHGNSA-N |
| XLogP | 1.13 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|