C10H12NO7- — CID 6999583
(2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-hydroxypropanoate (PubChem CID 6999583) has the molecular formula C10H12NO7- and a molecular weight of 258.21 g/mol. Its IUPAC name is (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-hydroxypropanoate.
| Compound Name | (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 6999583 |
| Molecular Formula | C10H12NO7- |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (2S)-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-3-hydroxypropanoate |
| SMILES | CC1(C)OC(=O)C(/C=N/[C@@H](CO)C(=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C10H13NO7/c1-10(2)17-8(15)5(9(16)18-10)3-11-6(4-12)7(13)14/h3,5-6,12H,4H2,1-2H3,(H,13,14)/p-1/b11-3+/t6-/m0/s1 |
| InChIKey | CUURPUNEQZLVKO-QOCPSLBZSA-M |
| XLogP | -2.38 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|