About (2R)-1,1-diphenylpropan-2-ol
(2R)-1,1-diphenylpropan-2-ol (PubChem CID 6999740) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R)-1,1-diphenylpropan-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1-diphenylpropan-2-ol |
| PubChem CID | 6999740 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2R)-1,1-diphenylpropan-2-ol |
| SMILES | C[C@@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3/t12-/m1/s1 |
| InChIKey | BDZAWYBXBHTHFM-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1,1-diphenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-diphenylpropan-2-ol?
The IUPAC name of (2R)-1,1-diphenylpropan-2-ol (CID 6999740) is (2R)-1,1-diphenylpropan-2-ol.
What is the SMILES notation for (2R)-1,1-diphenylpropan-2-ol?
The canonical SMILES for (2R)-1,1-diphenylpropan-2-ol is C[C@@H](O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-1,1-diphenylpropan-2-ol?
The InChIKey is BDZAWYBXBHTHFM-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H16O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3/t12-/m1/s1.
What are the key properties of (2R)-1,1-diphenylpropan-2-ol?
(2R)-1,1-diphenylpropan-2-ol has a molecular weight of 212.29 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-diphenylpropan-2-ol is sourced from PubChem (CID 6999740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).