About ethyl (2R)-2-chloropropanoate
ethyl (2R)-2-chloropropanoate (PubChem CID 6999808) has the molecular formula C5H9ClO2
and a molecular weight of 136.58 g/mol. Its IUPAC name is ethyl (2R)-2-chloropropanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-chloropropanoate |
| PubChem CID | 6999808 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | ethyl (2R)-2-chloropropanoate |
| SMILES | CCOC(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C5H9ClO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | JEAVBVKAYUCPAQ-SCSAIBSYSA-N |
| XLogP | 1.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-chloropropanoate?
The IUPAC name of ethyl (2R)-2-chloropropanoate (CID 6999808) is ethyl (2R)-2-chloropropanoate.
What is the SMILES notation for ethyl (2R)-2-chloropropanoate?
The canonical SMILES for ethyl (2R)-2-chloropropanoate is CCOC(=O)[C@@H](C)Cl.
What is the InChIKey of ethyl (2R)-2-chloropropanoate?
The InChIKey is JEAVBVKAYUCPAQ-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H9ClO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of ethyl (2R)-2-chloropropanoate?
ethyl (2R)-2-chloropropanoate has a molecular weight of 136.58 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-chloropropanoate is sourced from PubChem (CID 6999808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).