About (3S)-7-methoxy-3,7-dimethyloctanal
(3S)-7-methoxy-3,7-dimethyloctanal (PubChem CID 6999891) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is (3S)-7-methoxy-3,7-dimethyloctanal.
Molecular Properties
| Compound Name | (3S)-7-methoxy-3,7-dimethyloctanal |
| PubChem CID | 6999891 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3S)-7-methoxy-3,7-dimethyloctanal |
| SMILES | COC(C)(C)CCC[C@H](C)CC=O |
| InChI | InChI=1S/C11H22O2/c1-10(7-9-12)6-5-8-11(2,3)13-4/h9-10H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | IDWULKZGRNHZNR-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-methoxy-3,7-dimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-methoxy-3,7-dimethyloctanal?
The IUPAC name of (3S)-7-methoxy-3,7-dimethyloctanal (CID 6999891) is (3S)-7-methoxy-3,7-dimethyloctanal.
What is the SMILES notation for (3S)-7-methoxy-3,7-dimethyloctanal?
The canonical SMILES for (3S)-7-methoxy-3,7-dimethyloctanal is COC(C)(C)CCC[C@H](C)CC=O.
What is the InChIKey of (3S)-7-methoxy-3,7-dimethyloctanal?
The InChIKey is IDWULKZGRNHZNR-JTQLQIEISA-N. The full InChI is InChI=1S/C11H22O2/c1-10(7-9-12)6-5-8-11(2,3)13-4/h9-10H,5-8H2,1-4H3/t10-/m0/s1.
What are the key properties of (3S)-7-methoxy-3,7-dimethyloctanal?
(3S)-7-methoxy-3,7-dimethyloctanal has a molecular weight of 186.29 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-methoxy-3,7-dimethyloctanal is sourced from PubChem (CID 6999891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).