C10H18O2 — CID 6999957
(3R)-3,7-dimethyloct-6-enoic acid (PubChem CID 6999957) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3R)-3,7-dimethyloct-6-enoic acid.
| Compound Name | (3R)-3,7-dimethyloct-6-enoic acid |
|---|---|
| PubChem CID | 6999957 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3R)-3,7-dimethyloct-6-enoic acid |
| SMILES | CC(C)=CCC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m1/s1 |
| InChIKey | GJWSUKYXUMVMGX-SECBINFHSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|