About 9-ethylpurin-6-amine
9-ethylpurin-6-amine (PubChem CID 7) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 9-ethylpurin-6-amine.
Molecular Properties
| Compound Name | 9-ethylpurin-6-amine |
| PubChem CID | 7 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 9-ethylpurin-6-amine |
| SMILES | CCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C7H9N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h3-4H,2H2,1H3,(H2,8,9,10) |
| InChIKey | MUIPLRMGAXZWSQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-ethylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylpurin-6-amine?
The IUPAC name of 9-ethylpurin-6-amine (CID 7) is 9-ethylpurin-6-amine.
What is the SMILES notation for 9-ethylpurin-6-amine?
The canonical SMILES for 9-ethylpurin-6-amine is CCn1cnc2c(N)ncnc21.
What is the InChIKey of 9-ethylpurin-6-amine?
The InChIKey is MUIPLRMGAXZWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h3-4H,2H2,1H3,(H2,8,9,10).
What are the key properties of 9-ethylpurin-6-amine?
9-ethylpurin-6-amine has a molecular weight of 163.18 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylpurin-6-amine is sourced from PubChem (CID 7), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).