C16H22N2O3S — CID 70000023
1,1-dihydroxy-N-(3-pyrrolidin-1-ylpropyl)-1-benzothiophene-4-carboxamide (PubChem CID 70000023) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1,1-dihydroxy-N-(3-pyrrolidin-1-ylpropyl)-1-benzothiophene-4-carboxamide.
| Compound Name | 1,1-dihydroxy-N-(3-pyrrolidin-1-ylpropyl)-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 70000023 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1,1-dihydroxy-N-(3-pyrrolidin-1-ylpropyl)-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1cccc2c1C=CS2(O)O |
| InChI | InChI=1S/C16H22N2O3S/c19-16(17-8-4-11-18-9-1-2-10-18)14-5-3-6-15-13(14)7-12-22(15,20)21/h3,5-7,12,20-21H,1-2,4,8-11H2,(H,17,19) |
| InChIKey | XUYXPTNCEXGPSX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|