C16H21F3N2O2S — CID 70000045
(2S,6R)-2,6-dimethyl-1-prop-2-enyl-4-[3-(trifluoromethylsulfonyl)phenyl]piperazine (PubChem CID 70000045) has the molecular formula C16H21F3N2O2S and a molecular weight of 362.42 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-prop-2-enyl-4-[3-(trifluoromethylsulfonyl)phenyl]piperazine.
| Compound Name | (2S,6R)-2,6-dimethyl-1-prop-2-enyl-4-[3-(trifluoromethylsulfonyl)phenyl]piperazine |
|---|---|
| PubChem CID | 70000045 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-prop-2-enyl-4-[3-(trifluoromethylsulfonyl)phenyl]piperazine |
| SMILES | C=CCN1[C@H](C)CN(c2cccc(S(=O)(=O)C(F)(F)F)c2)C[C@@H]1C |
| InChI | InChI=1S/C16H21F3N2O2S/c1-4-8-21-12(2)10-20(11-13(21)3)14-6-5-7-15(9-14)24(22,23)16(17,18)19/h4-7,9,12-13H,1,8,10-11H2,2-3H3/t12-,13+ |
| InChIKey | NBSKLLFTDPPUKR-BETUJISGSA-N |
| XLogP | 3.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|