About 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene
3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene (PubChem CID 70000074) has the molecular formula C15H16O5S2
and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene |
| PubChem CID | 70000074 |
| Molecular Formula | C15H16O5S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene |
| SMILES | COc1ccc2c(c1)C(S(=O)(=O)c1ccccc1)CS2(O)O |
| InChI | InChI=1S/C15H16O5S2/c1-20-11-7-8-14-13(9-11)15(10-21(14,16)17)22(18,19)12-5-3-2-4-6-12/h2-9,15-17H,10H2,1H3 |
| InChIKey | ZSGNTNVTINQDLG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene?
The IUPAC name of 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene (CID 70000074) is 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene.
What is the SMILES notation for 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene?
The canonical SMILES for 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene is COc1ccc2c(c1)C(S(=O)(=O)c1ccccc1)CS2(O)O.
What is the InChIKey of 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene?
The InChIKey is ZSGNTNVTINQDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5S2/c1-20-11-7-8-14-13(9-11)15(10-21(14,16)17)22(18,19)12-5-3-2-4-6-12/h2-9,15-17H,10H2,1H3.
What are the key properties of 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene?
3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene has a molecular weight of 340.42 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-1,1-dihydroxy-5-methoxy-2,3-dihydro-1-benzothiophene is sourced from PubChem (CID 70000074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).