C19H32O10Si — CID 70000769
1-hydroxy-1-[(2R,3S,4S,5R,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]propan-2-one (PubChem CID 70000769) has the molecular formula C19H32O10Si and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-hydroxy-1-[(2R,3S,4S,5R,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]propan-2-one.
| Compound Name | 1-hydroxy-1-[(2R,3S,4S,5R,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 70000769 |
| Molecular Formula | C19H32O10Si |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-hydroxy-1-[(2R,3S,4S,5R,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C(O)[C@H]1O[C@H](OCC[Si](C)(C)C)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C19H32O10Si/c1-10(20)14(24)15-17(25,11(2)21)19(27,13(4)23)18(26,12(3)22)16(29-15)28-8-9-30(5,6)7/h14-16,24-27H,8-9H2,1-7H3/t14?,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | YSHBDCYAHNTTBI-AQHULBSLSA-N |
| XLogP | -1.02 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|